cas: 2246887-09-0 — see every product listed under this CAS number, including other names
(4-(3,3-dimethylbutanamido)phenyl)boronic acid, 95%, 95% (CAS 2246887-09-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11SIIB-250mg |
| cas | 2246887-09-0 |
| size | 250mg |
| availability | 9.85g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1576.40 Pln | |
| Chemat | 5g | 4749.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(3,3-dimethylbutanoylamino)phenyl]boronic acid (CAS 2246887-09-0) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: [4-(3,3-dimethylbutanoylamino)phenyl]boronic acid. InChIKey: FVYFFUGICORKLG-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | [4-(3,3-dimethylbutanoylamino)phenyl]boronic acid |
| InChIKey | FVYFFUGICORKLG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)CC(C)(C)C)(O)O |
Computed by PubChem (NCBI)