Products 2246831-80-9
CAS 2246831-80-9 appears in our catalog under these names: 3-(4-Methylpentanamido)phenylboronic acid, 95%, (3-(4-Methylpentanamido)phenyl)boronic acid, 98%, 3–(4–methylpentanamido)phenylboronic acid, (3-(4-Methylpentanamido)phenyl)boronic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg.
[3-(4-methylpentanoylamino)phenyl]boronic acid (CAS 2246831-80-9) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: [3-(4-methylpentanoylamino)phenyl]boronic acid. InChIKey: OMBYASWOTHSBET-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | [3-(4-methylpentanoylamino)phenyl]boronic acid |
| InChIKey | OMBYASWOTHSBET-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)CCC(C)C)(O)O |
Computed by PubChem (NCBI)