CAS 1256345-93-3 is the registry number for 2-(tert-Butylcarbamoyl)benzylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
[2-(tert-butylcarbamoyl)phenyl]methylboronic acid (CAS 1256345-93-3) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: [2-(tert-butylcarbamoyl)phenyl]methylboronic acid. InChIKey: CYSROIZKFPZUBZ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | [2-(tert-butylcarbamoyl)phenyl]methylboronic acid |
| InChIKey | CYSROIZKFPZUBZ-UHFFFAOYSA-N |
| SMILES | B(CC1=CC=CC=C1C(=O)NC(C)(C)C)(O)O |
Computed by PubChem (NCBI)