Products 1256345-93-3

CAS 1256345-93-3 is the registry number for 2-(tert-Butylcarbamoyl)benzylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

[2-(tert-butylcarbamoyl)phenyl]methylboronic acid (CAS 1256345-93-3) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: [2-(tert-butylcarbamoyl)phenyl]methylboronic acid. InChIKey: CYSROIZKFPZUBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18BNO3
Molecular weight235.09 g/mol
IUPAC name[2-(tert-butylcarbamoyl)phenyl]methylboronic acid
InChIKeyCYSROIZKFPZUBZ-UHFFFAOYSA-N
SMILESB(CC1=CC=CC=C1C(=O)NC(C)(C)C)(O)O

Computed by PubChem (NCBI)