CAS 2246887-09-0 appears in our catalog under these names: [4-(3,3-Dimethylbutanamido)phenyl]boronic acid, 95%, (4-(3,3-Dimethylbutanamido)phenyl)boronic acid, 98%, (4–(3,3–dimethylbutanamido)phenyl)boronic acid, (4-(3,3-dimethylbutanamido)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg.
[4-(3,3-dimethylbutanoylamino)phenyl]boronic acid (CAS 2246887-09-0) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: [4-(3,3-dimethylbutanoylamino)phenyl]boronic acid. InChIKey: FVYFFUGICORKLG-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | [4-(3,3-dimethylbutanoylamino)phenyl]boronic acid |
| InChIKey | FVYFFUGICORKLG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)CC(C)(C)C)(O)O |
Computed by PubChem (NCBI)