CAS 2246581-88-2 appears in our catalog under these names: (4-((3-Methylbutanamido)methyl)phenyl)boronic acid, 95%, (4–((3–methylbutanamido)methyl)phenyl)boronic acid, (4-((3-methylbutanamido)methyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg.
[4-[(3-methylbutanoylamino)methyl]phenyl]boronic acid (CAS 2246581-88-2) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: [4-[(3-methylbutanoylamino)methyl]phenyl]boronic acid. InChIKey: QDHBRPLTUFUUBN-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | [4-[(3-methylbutanoylamino)methyl]phenyl]boronic acid |
| InChIKey | QDHBRPLTUFUUBN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC(=O)CC(C)C)(O)O |
Computed by PubChem (NCBI)