CAS 1256345-94-4 is the registry number for 2-(t-Butylcarbamoyl)-4-methylphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
[2-(tert-butylcarbamoyl)-4-methylphenyl]boronic acid (CAS 1256345-94-4) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: [2-(tert-butylcarbamoyl)-4-methylphenyl]boronic acid. InChIKey: HHEYETCZZMBIQW-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | [2-(tert-butylcarbamoyl)-4-methylphenyl]boronic acid |
| InChIKey | HHEYETCZZMBIQW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C)C(=O)NC(C)(C)C)(O)O |
Computed by PubChem (NCBI)