(4-(3-Methoxy-3-oxopropyl)phenyl)boronic acid, 98%
cas: 850568-44-4 — see every product listed under this CAS number, including other names
(4-(3-Methoxy-3-oxopropyl)phenyl)boronic acid, 98% (CAS 850568-44-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch115SI1-50mg |
| cas | 850568-44-4 |
| size | 50mg |
| availability | 15g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 136.40 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1638.80 Pln | |
| Chemat | 10g | 2958.80 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 569.82 Pln | |
| BLDpharm | 5g | 1980.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(3-methoxy-3-oxopropyl)phenyl]boronic acid (CAS 850568-44-4) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: [4-(3-methoxy-3-oxopropyl)phenyl]boronic acid. InChIKey: XRKIHUXCUIFHAS-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | [4-(3-methoxy-3-oxopropyl)phenyl]boronic acid |
| InChIKey | XRKIHUXCUIFHAS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCC(=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(2-Methoxycarbonylethyl)benzeneboronic acid, [4-(3-methoxy-3-oxopropyl)phenyl]boronic acid, [4-(2-methoxycarbonylethyl)phenyl]boronic Acid, 4-(3-methoxy-3-oxopropyl)phenylboronic acid, 4-(2-methoxycarbonylethyl)phenyl boronic acid, [4-(3-methoxy-3-oxo-propyl)phenyl]boronic acid, orb3176712, 4-(3-m