Products 1187209-18-2
CAS 1187209-18-2 appears in our catalog under these names: 2-(4-Boronophenyl)-2-methylpropanoic acid, 98%, 2-(4-Boronophenyl)-2-methylpropanoic acid 95%, 2-(4-Boronophenyl)-2-methylpropanoic acid, 97%, 2-(4-Boronophenyl)-2-methylpropanoic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-(4-boronophenyl)-2-methylpropanoic acid (CAS 1187209-18-2) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: 2-(4-boronophenyl)-2-methylpropanoic acid. InChIKey: QAMVLOFDQNAZOP-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | 2-(4-boronophenyl)-2-methylpropanoic acid |
| InChIKey | QAMVLOFDQNAZOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)(C)C(=O)O)(O)O |
Computed by PubChem (NCBI)