cas: 1448189-30-7 — see every product listed under this CAS number, including other names
(4-(4-Methylthiazol-5-yl)phenyl)methanamine 95% (CAS 1448189-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A933581-100mg |
| cas | 1448189-30-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A933581 |
[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine (CAS 1448189-30-7) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine. InChIKey: PCZXZPOWHWJXDZ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine |
| InChIKey | PCZXZPOWHWJXDZ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)