cas: 1448189-30-7 — see every product listed under this CAS number, including other names
(4-(4-Methylthiazol-5-yl)phenyl)methanamine, 97%, 97% (CAS 1448189-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12B6LZ-100mg |
| cas | 1448189-30-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1715.60 Pln | |
| Chemat | 25g | 3371.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine (CAS 1448189-30-7) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine. InChIKey: PCZXZPOWHWJXDZ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine |
| InChIKey | PCZXZPOWHWJXDZ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)