CAS 247225-31-6 appears in our catalog under these names: 4-(2,4-Dimethylphenyl)-1,3-thiazol-2-amine, 95%, 4-(2,4-Dimethylphenyl)-1,3-thiazol-2-amine, 4-(2,4-Dimethylphenyl)thiazol-2-amine 95%, 4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine, 95%, 95%, 4-(2,4-Dimethylphenyl)thiazol-2-ylamine, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 2000mg, 5000mg, 250mg, 500mg, 2g.
4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine (CAS 247225-31-6) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine. InChIKey: OJXMEMYRDCFPHW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | OJXMEMYRDCFPHW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CSC(=N2)N)C |
Computed by PubChem (NCBI)