CAS 4602-37-3 is the registry number for 2,2-Dimethyl-4-phenyl-2,5-dihydro-1h-imidazole-5-thione, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,2-dimethyl-4-phenyl-1H-imidazole-5-thione (CAS 4602-37-3) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 2,2-dimethyl-4-phenyl-1H-imidazole-5-thione. InChIKey: QUDYXWDELXIWSL-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 2,2-dimethyl-4-phenyl-1H-imidazole-5-thione |
| InChIKey | QUDYXWDELXIWSL-UHFFFAOYSA-N |
| SMILES | CC1(NC(=S)C(=N1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)