CAS 89152-85-2 is the registry number for [2-(3-Methylphenyl)-1,3-thiazol-4-yl]methylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
[2-(3-methylphenyl)-1,3-thiazol-4-yl]methanamine (CAS 89152-85-2) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: [2-(3-methylphenyl)-1,3-thiazol-4-yl]methanamine. InChIKey: DBRGOSWTMATQKR-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | [2-(3-methylphenyl)-1,3-thiazol-4-yl]methanamine |
| InChIKey | DBRGOSWTMATQKR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC(=CS2)CN |
Computed by PubChem (NCBI)