CAS 5702-69-2 appears in our catalog under these names: 1,5-Dimethyl-2-phenyl-1,2-dihydro-3h-pyrazole-3-thione, 95%, 1,5-Dimethyl-2-phenyl-1H-pyrazole-3(2H)-thione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1,5-dimethyl-2-phenylpyrazole-3-thione (CAS 5702-69-2) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 1,5-dimethyl-2-phenylpyrazole-3-thione. InChIKey: BKHQZVDOSQVERW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 1,5-dimethyl-2-phenylpyrazole-3-thione |
| InChIKey | BKHQZVDOSQVERW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=S)N(N1C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)