(4-(Acetoxymethyl)phenyl)boronic acid, 98%
cas: 326496-51-9 — see every product listed under this CAS number, including other names
(4-(Acetoxymethyl)phenyl)boronic acid, 98% (CAS 326496-51-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A588061-250mg |
| cas | 326496-51-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1538.50 Pln | |
| Ambeed | 25g | 7390.25 Pln | |
| BLDpharm | 250mg | 281.04 Pln | |
| BLDpharm | 1g | 464.31 Pln | |
| BLDpharm | 5g | 1652.78 Pln | |
| BLDpharm | 25g | 7961.67 Pln | |
| Fluorochem | 250mg | 492.55 Pln | |
| Fluorochem | 1g | 1148.57 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[4-(acetyloxymethyl)phenyl]boronic acid (CAS 326496-51-9) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: [4-(acetyloxymethyl)phenyl]boronic acid. InChIKey: FPQABEOUQSYDPY-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | [4-(acetyloxymethyl)phenyl]boronic acid |
| InChIKey | FPQABEOUQSYDPY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)COC(=O)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-(Acetoxymethyl)phenyl)boronic acid, (4-Acetoxymethyl)phenylboronic acid, [4-(acetyloxymethyl)phenyl]boronic Acid, {4-[(Acetyloxy)methyl]phenyl}boronic acid, 4-(Acetoxymethyl)benzeneboronic acid, [4-(Acetoxymethyl)phenyl]boronic acid, 4-Acetoxymethylbenzeneboronic acid, (4-Acetoxymet, (4-(Acetoxymethyl)phenyl)boronicacid