cas: 850568-76-2 — see every product listed under this CAS number, including other names
(4-(N,N-Diethylsulfamoyl)phenyl)boronic acid 98% (CAS 850568-76-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A668301-250mg |
| cas | 850568-76-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1638.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A668301 |
[4-(diethylsulfamoyl)phenyl]boronic acid (CAS 850568-76-2) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [4-(diethylsulfamoyl)phenyl]boronic acid. InChIKey: HMGSSHUKMMHXLR-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [4-(diethylsulfamoyl)phenyl]boronic acid |
| InChIKey | HMGSSHUKMMHXLR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N(CC)CC)(O)O |
Computed by PubChem (NCBI)