CAS 2246751-62-0 appears in our catalog under these names: 5-(BOC-Aminomethyl)thiophene-3-boronic acid, 98%, 5-(BOC-AMINOMETHYL)THIOPHENE-3-BORONIC ACID, 98%, 98%, (5-(((tert-Butoxycarbonyl)amino)methyl)thiophen-3-yl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]thiophen-3-yl]boronic acid (CAS 2246751-62-0) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]thiophen-3-yl]boronic acid. InChIKey: IGJFBQDBUNTHII-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]thiophen-3-yl]boronic acid |
| InChIKey | IGJFBQDBUNTHII-UHFFFAOYSA-N |
| SMILES | B(C1=CSC(=C1)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)