Products 850589-32-1
CAS 850589-32-1 appears in our catalog under these names: N-Butyl 4-boronobenzenesulfonamide, 97%, (4-(N-Butylsulfamoyl)phenyl)boronic acid, 95%, 95%, (4-(n-Butylsulfamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.
[4-(butylsulfamoyl)phenyl]boronic acid (CAS 850589-32-1) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [4-(butylsulfamoyl)phenyl]boronic acid. InChIKey: BEBIGVQNUYZEPK-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [4-(butylsulfamoyl)phenyl]boronic acid |
| InChIKey | BEBIGVQNUYZEPK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCCCC)(O)O |
Computed by PubChem (NCBI)