CAS 850568-76-2 appears in our catalog under these names: N,N-Diethyl 4-boronobenzenesulfonamide, 98%, (4–(diethylsulfamoyl)phenyl)boronic acid, (4-(N,N-Diethylsulfamoyl)phenyl)boronic acid, 98%, 98%, (4-(N,N-Diethylsulfamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
[4-(diethylsulfamoyl)phenyl]boronic acid (CAS 850568-76-2) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [4-(diethylsulfamoyl)phenyl]boronic acid. InChIKey: HMGSSHUKMMHXLR-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [4-(diethylsulfamoyl)phenyl]boronic acid |
| InChIKey | HMGSSHUKMMHXLR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N(CC)CC)(O)O |
Computed by PubChem (NCBI)