CAS 871329-78-1 appears in our catalog under these names: N-Butyl 3-boronobenzenesulfonamide, 95%, N-Butyl 3-boronobenzenesulfonamide, 95%, 95%, (3-(N-Butylsulfamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
[3-(butylsulfamoyl)phenyl]boronic acid (CAS 871329-78-1) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [3-(butylsulfamoyl)phenyl]boronic acid. InChIKey: LDUILYZFVFIMFG-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [3-(butylsulfamoyl)phenyl]boronic acid |
| InChIKey | LDUILYZFVFIMFG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)(=O)NCCCC)(O)O |
Computed by PubChem (NCBI)