Products 1704067-27-5
CAS 1704067-27-5 appears in our catalog under these names: (4-(N,N-Dimethylsulfamoyl)-3,5-dimethylphenyl)boronic acid, 95%, (4–(N，N–Dimethylsulfamoyl)–3，5–dimethylphenyl)boronic acid, 4-(N,N-dimethylsulfamoyl)-3,5-dimethylphenylboronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 500mg.
[4-(dimethylsulfamoyl)-3,5-dimethylphenyl]boronic acid (CAS 1704067-27-5) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [4-(dimethylsulfamoyl)-3,5-dimethylphenyl]boronic acid. InChIKey: LXLPZSFYAKFYEA-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [4-(dimethylsulfamoyl)-3,5-dimethylphenyl]boronic acid |
| InChIKey | LXLPZSFYAKFYEA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)N(C)C)C)(O)O |
Computed by PubChem (NCBI)