cas: 208516-15-8 — see every product listed under this CAS number, including other names
(4-(N-(tert-Butyl)sulfamoyl)phenyl)boronic acid (CAS 208516-15-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235034-100MG |
| cas | 208516-15-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 1788.97 Pln | |
| Fluorochem | 25g | 6693.49 Pln |
| delivery time | 3-4 weeks |
|---|
[4-(tert-butylsulfamoyl)phenyl]boronic acid (CAS 208516-15-8) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [4-(tert-butylsulfamoyl)phenyl]boronic acid. InChIKey: BBTSLOMTYZIGGC-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [4-(tert-butylsulfamoyl)phenyl]boronic acid |
| InChIKey | BBTSLOMTYZIGGC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC(C)(C)C)(O)O |
Computed by PubChem (NCBI)