cas: 850589-32-1 — see every product listed under this CAS number, including other names
(4-(n-Butylsulfamoyl)phenyl)boronic acid, 95% (CAS 850589-32-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692507-1G |
| cas | 850589-32-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 763.29 Pln | |
| Fluorochem | 5g | 2132.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[4-(butylsulfamoyl)phenyl]boronic acid (CAS 850589-32-1) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [4-(butylsulfamoyl)phenyl]boronic acid. InChIKey: BEBIGVQNUYZEPK-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [4-(butylsulfamoyl)phenyl]boronic acid |
| InChIKey | BEBIGVQNUYZEPK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCCCC)(O)O |
Computed by PubChem (NCBI)