(4-(tert-Butylthio)phenyl)boronic acid, 98%
cas: 820972-68-7 — see every product listed under this CAS number, including other names
(4-(tert-Butylthio)phenyl)boronic acid, 98% (CAS 820972-68-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A406046-100mg |
| cas | 820972-68-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 659.62 Pln | |
| Ambeed | 5g | 2122.56 Pln | |
| Ambeed | 10g | 3663.37 Pln | |
| Ambeed | 25g | 7256.75 Pln | |
| BLDpharm | 100mg | 192.18 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 703.11 Pln | |
| BLDpharm | 5g | 2285.89 Pln | |
| BLDpharm | 10g | 3946.41 Pln | |
| BLDpharm | 25g | 7817.27 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(4-tert-butylsulfanylphenyl)boronic acid (CAS 820972-68-7) is a chemical compound with the molecular formula C10H15BO2S and a molecular weight of 210.11 g/mol. IUPAC name: (4-tert-butylsulfanylphenyl)boronic acid. InChIKey: RLSGPRQEFFGNKS-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2S |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | (4-tert-butylsulfanylphenyl)boronic acid |
| InChIKey | RLSGPRQEFFGNKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SC(C)(C)C)(O)O |
Computed by PubChem (NCBI)