4-(TERT-BUTYLTHIO)PHENYLBORONIC ACID, 98%
cas: 820972-68-7 — see every product listed under this CAS number, including other names
4-(TERT-BUTYLTHIO)PHENYLBORONIC ACID, 98% (CAS 820972-68-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1162VG-100mg |
| cas | 820972-68-7 |
| size | 100mg |
| availability | 125g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 654.80 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3678.80 Pln | |
| Chemat | 25g | 7293.20 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 1g | 1211.05 Pln | |
| Fluorochem | 5g | 3934.05 Pln | |
| Fluorochem | 25g | 13305.75 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-tert-butylsulfanylphenyl)boronic acid (CAS 820972-68-7) is a chemical compound with the molecular formula C10H15BO2S and a molecular weight of 210.11 g/mol. IUPAC name: (4-tert-butylsulfanylphenyl)boronic acid. InChIKey: RLSGPRQEFFGNKS-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2S |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | (4-tert-butylsulfanylphenyl)boronic acid |
| InChIKey | RLSGPRQEFFGNKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SC(C)(C)C)(O)O |
Computed by PubChem (NCBI)