cas: 1451391-29-9 — see every product listed under this CAS number, including other names
(4-Bromo-2,3-dimethylphenyl)boronic acid, 98+% (CAS 1451391-29-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A579547-25g |
| cas | 1451391-29-9 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 38661.28 Pln | |
| AmBeed | 10g | 19704.16 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-bromo-2,3-dimethylphenyl)boronic acid (CAS 1451391-29-9) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (4-bromo-2,3-dimethylphenyl)boronic acid. InChIKey: WKRSZLGVZKKFTJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (4-bromo-2,3-dimethylphenyl)boronic acid |
| InChIKey | WKRSZLGVZKKFTJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Br)C)C)(O)O |
Computed by PubChem (NCBI)