cas: 220996-81-6 — see every product listed under this CAS number, including other names
(4-Bromo-2-(trifluoromethoxy)phenyl)methanol 97% (CAS 220996-81-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A120033-250mg |
| cas | 220996-81-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 1354.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A120033 |
[4-bromo-2-(trifluoromethoxy)phenyl]methanol (CAS 220996-81-6) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: [4-bromo-2-(trifluoromethoxy)phenyl]methanol. InChIKey: CMVFMHREHCVREX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | [4-bromo-2-(trifluoromethoxy)phenyl]methanol |
| InChIKey | CMVFMHREHCVREX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)OC(F)(F)F)CO |
Computed by PubChem (NCBI)