cas: 220996-81-6 — see every product listed under this CAS number, including other names
4-Bromo-2-(trifluoromethoxy)benzenemethanol, 96%, 96% (CAS 220996-81-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BEEI-100mg |
| cas | 220996-81-6 |
| size | 100mg |
| availability | 14.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 10g | 458.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[4-bromo-2-(trifluoromethoxy)phenyl]methanol (CAS 220996-81-6) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: [4-bromo-2-(trifluoromethoxy)phenyl]methanol. InChIKey: CMVFMHREHCVREX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | [4-bromo-2-(trifluoromethoxy)phenyl]methanol |
| InChIKey | CMVFMHREHCVREX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)OC(F)(F)F)CO |
Computed by PubChem (NCBI)