cas: 156487-12-6 — see every product listed under this CAS number, including other names
(4-Butoxy-2,3-difluorophenyl)boronic acid, 97% (CAS 156487-12-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211411-5G |
| cas | 156487-12-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 10g | 393.63 Pln | |
| Fluorochem | 25g | 877.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(4-butoxy-2,3-difluorophenyl)boronic acid (CAS 156487-12-6) is a chemical compound with the molecular formula C10H13BF2O3 and a molecular weight of 230.02 g/mol. IUPAC name: (4-butoxy-2,3-difluorophenyl)boronic acid. InChIKey: NVIGFYPVKZNNAZ-UHFFFAOYSA-N.
| Molecular formula | C10H13BF2O3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | (4-butoxy-2,3-difluorophenyl)boronic acid |
| InChIKey | NVIGFYPVKZNNAZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCCCC)F)F)(O)O |
Computed by PubChem (NCBI)