cas: 156487-12-6 — see every product listed under this CAS number, including other names
4-Butoxy-2,3-difluorophenylboronic Acid (contains varying amounts of Anhydride) (CAS 156487-12-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B5174-1G |
| cas | 156487-12-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 265.86 Pln | |
| TCI | 5g | 841.18 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
(4-butoxy-2,3-difluorophenyl)boronic acid (CAS 156487-12-6) is a chemical compound with the molecular formula C10H13BF2O3 and a molecular weight of 230.02 g/mol. IUPAC name: (4-butoxy-2,3-difluorophenyl)boronic acid. InChIKey: NVIGFYPVKZNNAZ-UHFFFAOYSA-N.
| Molecular formula | C10H13BF2O3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | (4-butoxy-2,3-difluorophenyl)boronic acid |
| InChIKey | NVIGFYPVKZNNAZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCCCC)F)F)(O)O |
Computed by PubChem (NCBI)