cas: 1218790-72-7 — see every product listed under this CAS number, including other names
(4-Butoxy-3,5-dichlorophenyl)boronic acid, 98% (CAS 1218790-72-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A444788-1g |
| cas | 1218790-72-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 239.26 Pln | |
| AmBeed | 250mg | 206.71 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-butoxy-3,5-dichlorophenyl)boronic acid (CAS 1218790-72-7) is a chemical compound with the molecular formula C10H13BCl2O3 and a molecular weight of 262.92 g/mol. IUPAC name: (4-butoxy-3,5-dichlorophenyl)boronic acid. InChIKey: CZGPPYHWISSCGP-UHFFFAOYSA-N.
| Molecular formula | C10H13BCl2O3 |
|---|---|
| Molecular weight | 262.92 g/mol |
| IUPAC name | (4-butoxy-3,5-dichlorophenyl)boronic acid |
| InChIKey | CZGPPYHWISSCGP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OCCCC)Cl)(O)O |
Computed by PubChem (NCBI)