CAS 1618668-22-6 appears in our catalog under these names: 2-(2,5-Dichlorofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(2,5-Dichlorofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-(2,5-dichlorofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1618668-22-6) is a chemical compound with the molecular formula C10H13BCl2O3 and a molecular weight of 262.92 g/mol. IUPAC name: 2-(2,5-dichlorofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IMSVSVGCLUCKKW-UHFFFAOYSA-N.
| Molecular formula | C10H13BCl2O3 |
|---|---|
| Molecular weight | 262.92 g/mol |
| IUPAC name | 2-(2,5-dichlorofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IMSVSVGCLUCKKW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(OC(=C2)Cl)Cl |
Computed by PubChem (NCBI)