(4-Butoxy-3-chlorophenyl)boronic acid, 95%
cas: 480438-55-9 — see every product listed under this CAS number, including other names
(4-Butoxy-3-chlorophenyl)boronic acid, 95% (CAS 480438-55-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A158221-250mg |
| cas | 480438-55-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 414.88 Pln | |
| Ambeed | 25g | 1471.75 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 247.72 Pln | |
| BLDpharm | 5g | 442.09 Pln | |
| BLDpharm | 25g | 1580.58 Pln | |
| Fluorochem | 5g | 830.98 Pln | |
| Fluorochem | 1g | 367.60 Pln | |
| Fluorochem | 25g | 3538.36 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4-butoxy-3-chlorophenyl)boronic acid (CAS 480438-55-9) is a chemical compound with the molecular formula C10H14BClO3 and a molecular weight of 228.48 g/mol. IUPAC name: (4-butoxy-3-chlorophenyl)boronic acid. InChIKey: AOKJNAVCTPBFPJ-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO3 |
|---|---|
| Molecular weight | 228.48 g/mol |
| IUPAC name | (4-butoxy-3-chlorophenyl)boronic acid |
| InChIKey | AOKJNAVCTPBFPJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCCCC)Cl)(O)O |
Computed by PubChem (NCBI)