cas: 1056475-86-5 — see every product listed under this CAS number, including other names
(4-Chloro-3,5-dimethylphenyl)boronic acid 96% (CAS 1056475-86-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A715982-100mg |
| cas | 1056475-86-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 826.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A715982 |
(4-chloro-3,5-dimethylphenyl)boronic acid (CAS 1056475-86-5) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: (4-chloro-3,5-dimethylphenyl)boronic acid. InChIKey: BDAZHAUVPSQIKL-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | (4-chloro-3,5-dimethylphenyl)boronic acid |
| InChIKey | BDAZHAUVPSQIKL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)Cl)C)(O)O |
Computed by PubChem (NCBI)