Products 2377587-47-6
CAS 2377587-47-6 is the registry number for 4-(1-Chloroethyl)phenylboronic acid, 96%. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
[4-(1-chloroethyl)phenyl]boronic acid (CAS 2377587-47-6) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: [4-(1-chloroethyl)phenyl]boronic acid. InChIKey: LAQJSRJJSVCVFU-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | [4-(1-chloroethyl)phenyl]boronic acid |
| InChIKey | LAQJSRJJSVCVFU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)Cl)(O)O |
Computed by PubChem (NCBI)