Products 2377606-16-9
CAS 2377606-16-9 is the registry number for 3-Chloromethyl-4-methylphenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
[3-(chloromethyl)-4-methylphenyl]boronic acid (CAS 2377606-16-9) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: [3-(chloromethyl)-4-methylphenyl]boronic acid. InChIKey: XVBKEZIAHHACHD-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | [3-(chloromethyl)-4-methylphenyl]boronic acid |
| InChIKey | XVBKEZIAHHACHD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)CCl)(O)O |
Computed by PubChem (NCBI)