CAS 2246683-46-3 appears in our catalog under these names: (2-chloro-4,5-dimethylphenyl)boronic acid, 95%, (2-chloro-4,5-dimethylphenyl)boronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g.
(2-chloro-4,5-dimethylphenyl)boronic acid (CAS 2246683-46-3) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: (2-chloro-4,5-dimethylphenyl)boronic acid. InChIKey: IZISMMRQFIVXCU-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | (2-chloro-4,5-dimethylphenyl)boronic acid |
| InChIKey | IZISMMRQFIVXCU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)C)C)(O)O |
Computed by PubChem (NCBI)