CAS 1056475-86-5 appears in our catalog under these names: 3,5-Dimethyl-4-chlorophenylboronic acid, 96%, (4–Chloro–3,5–dimethylphenyl)boronic acid, (4-Chloro-3,5-dimethylphenyl)boronic acid 96%, 3,5-DIMETHYL-4-CHLOROPHENYLBORONIC ACID, 96%, 96%, (4-Chloro-3,5-dimethylphenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
(4-chloro-3,5-dimethylphenyl)boronic acid (CAS 1056475-86-5) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: (4-chloro-3,5-dimethylphenyl)boronic acid. InChIKey: BDAZHAUVPSQIKL-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | (4-chloro-3,5-dimethylphenyl)boronic acid |
| InChIKey | BDAZHAUVPSQIKL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)Cl)C)(O)O |
Computed by PubChem (NCBI)