CAS 2121515-11-3 appears in our catalog under these names: 3-Chloro-2,4-dimethylphenylboronic acid, 3-Chloro-2,4-dimethylphenylboronic acid, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 5g, 1g, 10g, 25g, 250mg.
(3-chloro-2,4-dimethylphenyl)boronic acid (CAS 2121515-11-3) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: (3-chloro-2,4-dimethylphenyl)boronic acid. InChIKey: RZWIRIWFGDHDJC-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | (3-chloro-2,4-dimethylphenyl)boronic acid |
| InChIKey | RZWIRIWFGDHDJC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C)Cl)C)(O)O |
Computed by PubChem (NCBI)