(4-Cyclopropyl-2-fluorophenyl)boronic acid, 98%
cas: 2225175-39-1 — see every product listed under this CAS number, including other names
(4-Cyclopropyl-2-fluorophenyl)boronic acid, 98% (CAS 2225175-39-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1478836-50mg |
| cas | 2225175-39-1 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1288.19 Pln | |
| Ambeed | 100mg | 2133.69 Pln | |
| Ambeed | 250mg | 3585.50 Pln | |
| Ambeed | 1g | 9565.19 Pln | |
| Chemat | 50mg | 808.40 Pln | |
| Chemat | 100mg | 1331.60 Pln | |
| Chemat | 250mg | 2210.00 Pln | |
| Chemat | 1g | 5862.80 Pln | |
| BLDpharm | 50mg | 1264.02 Pln | |
| BLDpharm | 100mg | 2097.06 Pln | |
| BLDpharm | 250mg | 3518.79 Pln | |
| BLDpharm | 1g | 9377.83 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(4-cyclopropyl-2-fluorophenyl)boronic acid (CAS 2225175-39-1) is a chemical compound with the molecular formula C9H10BFO2 and a molecular weight of 179.99 g/mol. IUPAC name: (4-cyclopropyl-2-fluorophenyl)boronic acid. InChIKey: HZSYHXSERFSUAI-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO2 |
|---|---|
| Molecular weight | 179.99 g/mol |
| IUPAC name | (4-cyclopropyl-2-fluorophenyl)boronic acid |
| InChIKey | HZSYHXSERFSUAI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C2CC2)F)(O)O |
Computed by PubChem (NCBI)