CAS 1393477-39-8 is the registry number for 6-Fluoro-3,3-dimethylbenzo(c)(1,2)oxaborol-1(3H)-ol, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-fluoro-1-hydroxy-3,3-dimethyl-2,1-benzoxaborole (CAS 1393477-39-8) is a chemical compound with the molecular formula C9H10BFO2 and a molecular weight of 179.99 g/mol. IUPAC name: 6-fluoro-1-hydroxy-3,3-dimethyl-2,1-benzoxaborole. InChIKey: OCMHEJQNUSELNA-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO2 |
|---|---|
| Molecular weight | 179.99 g/mol |
| IUPAC name | 6-fluoro-1-hydroxy-3,3-dimethyl-2,1-benzoxaborole |
| InChIKey | OCMHEJQNUSELNA-UHFFFAOYSA-N |
| SMILES | B1(C2=C(C=CC(=C2)F)C(O1)(C)C)O |
Computed by PubChem (NCBI)