CAS 1801916-30-2 appears in our catalog under these names: 2–Fluoro–3–cyclopropylphenylboronic acid, (3-Cyclopropyl-2-fluorophenyl)boronic acid, 95%. Offered by: GLPBio, Chemat Brand. Available pack sizes: 10mg, 25mg, on request.
(3-cyclopropyl-2-fluorophenyl)boronic acid (CAS 1801916-30-2) is a chemical compound with the molecular formula C9H10BFO2 and a molecular weight of 179.99 g/mol. IUPAC name: (3-cyclopropyl-2-fluorophenyl)boronic acid. InChIKey: JMUQOWZPVIAOCI-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO2 |
|---|---|
| Molecular weight | 179.99 g/mol |
| IUPAC name | (3-cyclopropyl-2-fluorophenyl)boronic acid |
| InChIKey | JMUQOWZPVIAOCI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C2CC2)F)(O)O |
Computed by PubChem (NCBI)