CAS 2225178-16-3 is the registry number for (3–cyclopropyl–4–fluorophenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(3-cyclopropyl-4-fluorophenyl)boronic acid (CAS 2225178-16-3) is a chemical compound with the molecular formula C9H10BFO2 and a molecular weight of 179.99 g/mol. IUPAC name: (3-cyclopropyl-4-fluorophenyl)boronic acid. InChIKey: DMUKASSACQAEIU-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO2 |
|---|---|
| Molecular weight | 179.99 g/mol |
| IUPAC name | (3-cyclopropyl-4-fluorophenyl)boronic acid |
| InChIKey | DMUKASSACQAEIU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C2CC2)(O)O |
Computed by PubChem (NCBI)