CAS 2225155-34-8 appears in our catalog under these names: (2-Cyclopropyl-5-fluorophenyl)boronic acid, 98%, (2–cyclopropyl–5–fluorophenyl)boronic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 10mg, 25mg.
(2-cyclopropyl-5-fluorophenyl)boronic acid (CAS 2225155-34-8) is a chemical compound with the molecular formula C9H10BFO2 and a molecular weight of 179.99 g/mol. IUPAC name: (2-cyclopropyl-5-fluorophenyl)boronic acid. InChIKey: PNRPDZUVVYXIDD-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO2 |
|---|---|
| Molecular weight | 179.99 g/mol |
| IUPAC name | (2-cyclopropyl-5-fluorophenyl)boronic acid |
| InChIKey | PNRPDZUVVYXIDD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)C2CC2)(O)O |
Computed by PubChem (NCBI)