cas: 859169-20-3 — see every product listed under this CAS number, including other names
(4-Ethoxycarbonylmethylphenyl)boronic acid pinacol ester, 97%, 97% (CAS 859169-20-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115MT7-100mg |
| cas | 859169-20-3 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 1216.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 859169-20-3) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: RPRBNRDIESZHFL-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | RPRBNRDIESZHFL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(=O)OCC |
Computed by PubChem (NCBI)