cas: 859169-20-3 — see every product listed under this CAS number, including other names
4-Ethoxycarbonylmethylphenylboronic acid pinacol ester, 98.0% (CAS 859169-20-3) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 5 g, 500 mg, 10 g, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-77699-1 g |
| cas | 859169-20-3 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 1127.75 Pln | |
| MedChemExpress | 5 g | 3143.24 Pln | |
| MedChemExpress | 500 mg | 793.38 Pln | |
| MedChemExpress | 10 g | 4652.54 Pln | |
| MedChemExpress | 100 mg | 333.62 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 859169-20-3) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: RPRBNRDIESZHFL-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | RPRBNRDIESZHFL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(=O)OCC |
Computed by PubChem (NCBI)