cas: 859169-20-3 — see every product listed under this CAS number, including other names
(4-Ethoxycarbonylmethylphenyl)boronic acid pinacol ester, 98% (CAS 859169-20-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078068-1G |
| cas | 859169-20-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 10g | 825.77 Pln | |
| Fluorochem | 25g | 1981.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 859169-20-3) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: RPRBNRDIESZHFL-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | RPRBNRDIESZHFL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(=O)OCC |
Computed by PubChem (NCBI)