cas: 1228829-13-7 — see every product listed under this CAS number, including other names
(4-Formyl-2,6-dimethylphenyl)boronic acid 98% (CAS 1228829-13-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A781741-100mg |
| cas | 1228829-13-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2778.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A781741 |
(4-formyl-2,6-dimethylphenyl)boronic acid (CAS 1228829-13-7) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-formyl-2,6-dimethylphenyl)boronic acid. InChIKey: MGJJTEKBMONTCP-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-formyl-2,6-dimethylphenyl)boronic acid |
| InChIKey | MGJJTEKBMONTCP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C=O)C)(O)O |
Computed by PubChem (NCBI)