cas: 186498-27-1 — see every product listed under this CAS number, including other names
(4-Isobutyrylphenyl)boronic acid (CAS 186498-27-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228681-100MG |
| cas | 186498-27-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1205.84 Pln |
| delivery time | 3-4 weeks |
|---|
[4-(2-methylpropanoyl)phenyl]boronic acid (CAS 186498-27-1) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: [4-(2-methylpropanoyl)phenyl]boronic acid. InChIKey: CFUNNCDOCRSHJT-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | [4-(2-methylpropanoyl)phenyl]boronic acid |
| InChIKey | CFUNNCDOCRSHJT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)C(C)C)(O)O |
Computed by PubChem (NCBI)