Products 1451390-85-4
CAS 1451390-85-4 appears in our catalog under these names: 4-Formyl-3-isopropylphenylboronic acid, 4-Formyl-3-isopropylphenylboronic acid, 95%, (4-Formyl-3-isopropylphenyl)boronic acid, 98+%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
(4-formyl-3-propan-2-ylphenyl)boronic acid (CAS 1451390-85-4) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: (4-formyl-3-propan-2-ylphenyl)boronic acid. InChIKey: JQKAUDYGGHSKEX-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | (4-formyl-3-propan-2-ylphenyl)boronic acid |
| InChIKey | JQKAUDYGGHSKEX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C=O)C(C)C)(O)O |
Computed by PubChem (NCBI)